Products 2225137-30-2
CAS 2225137-30-2 is the registry number for 3-(5-Methoxypyridin-2-yl)pyrrolidin-3-ol dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(5-methoxy-2-pyridinyl)pyrrolidin-3-ol;dihydrochloride (CAS 2225137-30-2) is a chemical compound with the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.15 g/mol. IUPAC name: 3-(5-methoxy-2-pyridinyl)pyrrolidin-3-ol;dihydrochloride. InChIKey: DIOBPOWCDIVSHN-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2O2 |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | 3-(5-methoxy-2-pyridinyl)pyrrolidin-3-ol;dihydrochloride |
| InChIKey | DIOBPOWCDIVSHN-UHFFFAOYSA-N |
| SMILES | COC1=CN=C(C=C1)C2(CCNC2)O.Cl.Cl |
Computed by PubChem (NCBI)