Products 2230200-77-6
CAS 2230200-77-6 is the registry number for Methyl (S)-5-nitro-6-((oxetan-2-ylmethyl)amino)picolinate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-nitro-6-[[(2S)-oxetan-2-yl]methylamino]pyridine-2-carboxylate (CAS 2230200-77-6) is a chemical compound with the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. IUPAC name: methyl 5-nitro-6-[[(2S)-oxetan-2-yl]methylamino]pyridine-2-carboxylate. InChIKey: ILKIHCYHKYHCLM-ZETCQYMHSA-N.
| Molecular formula | C11H13N3O5 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | methyl 5-nitro-6-[[(2S)-oxetan-2-yl]methylamino]pyridine-2-carboxylate |
| InChIKey | ILKIHCYHKYHCLM-ZETCQYMHSA-N |
| SMILES | COC(=O)C1=NC(=C(C=C1)[N+](=O)[O-])NC[C@@H]2CCO2 |
Computed by PubChem (NCBI)