Products 2241130-54-9
CAS 2241130-54-9 is the registry number for rac-Methyl (3R,5R)-5-tert-butylpiperidine-3-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl (3S,5S)-5-tert-butylpiperidine-3-carboxylate;hydrochloride (CAS 2241130-54-9) is a chemical compound with the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. IUPAC name: methyl (3S,5S)-5-tert-butylpiperidine-3-carboxylate;hydrochloride. InChIKey: JRYLTVZRVGGBLI-OULXEKPRSA-N.
| Molecular formula | C11H22ClNO2 |
|---|---|
| Molecular weight | 235.75 g/mol |
| IUPAC name | methyl (3S,5S)-5-tert-butylpiperidine-3-carboxylate;hydrochloride |
| InChIKey | JRYLTVZRVGGBLI-OULXEKPRSA-N |
| SMILES | CC(C)(C)[C@@H]1C[C@@H](CNC1)C(=O)OC.Cl |
Computed by PubChem (NCBI)