CAS 22821-83-6 is the registry number for 3-Methanesulfonylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-methylsulfonylbenzenesulfonamide (CAS 22821-83-6) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: 3-methylsulfonylbenzenesulfonamide. InChIKey: YUFIQCIEPNCJQE-UHFFFAOYSA-N.
| Molecular formula | C7H9NO4S2 |
|---|---|
| Molecular weight | 235.3 g/mol |
| IUPAC name | 3-methylsulfonylbenzenesulfonamide |
| InChIKey | YUFIQCIEPNCJQE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)