CAS 22985-02-0 is the registry number for Maturinone. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dimethylbenzo[f][1]benzofuran-4,9-dione (CAS 22985-02-0) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 3,5-dimethylbenzo[f][1]benzofuran-4,9-dione. InChIKey: CPZYZLPKCIMJGW-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3,5-dimethylbenzo[f][1]benzofuran-4,9-dione |
| InChIKey | CPZYZLPKCIMJGW-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)C3=C(C2=O)C(=CO3)C |
Computed by PubChem (NCBI)