CAS 236746-13-7 appears in our catalog under these names: (2E)-3-(2,3-Difluorophenyl)-2-propenoic Acid, (E)-3-(2,3-Difluorophenyl)acrylic acid 95+%, (E)-3-(2,3-Difluorophenyl)acrylic acid, 95%+, 95%+. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g.
(E)-3-(2,3-difluorophenyl)prop-2-enoic acid (CAS 236746-13-7) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: (E)-3-(2,3-difluorophenyl)prop-2-enoic acid. InChIKey: NVQHKPLMLCHFSU-SNAWJCMRSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | (E)-3-(2,3-difluorophenyl)prop-2-enoic acid |
| InChIKey | NVQHKPLMLCHFSU-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)