Products 2378507-01-6
CAS 2378507-01-6 is the registry number for (3,5-Dichloro-2-methoxyphenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3,5-dichloro-2-methoxyphenyl)methanamine;hydrochloride (CAS 2378507-01-6) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: (3,5-dichloro-2-methoxyphenyl)methanamine;hydrochloride. InChIKey: MWPFLHCRZRLZKA-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | (3,5-dichloro-2-methoxyphenyl)methanamine;hydrochloride |
| InChIKey | MWPFLHCRZRLZKA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)Cl)CN.Cl |
Computed by PubChem (NCBI)