CAS 24184-37-0 appears in our catalog under these names: Ethyl L-asparaginate hydrochloride, 97%, 97%, Ethyl L-asparaginate hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Ethyl (2S)-2,4-diamino-4-oxobutanoate;hydrochloride (CAS 24184-37-0) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: ethyl (2S)-2,4-diamino-4-oxobutanoate;hydrochloride. InChIKey: RIGBOVZPZYVXER-WCCKRBBISA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | ethyl (2S)-2,4-diamino-4-oxobutanoate;hydrochloride |
| InChIKey | RIGBOVZPZYVXER-WCCKRBBISA-N |
| SMILES | CCOC(=O)[C@H](CC(=O)N)N.Cl |
Computed by PubChem (NCBI)