CAS 24623-38-9 appears in our catalog under these names: 1,3–dichloro–5–methoxyisoquinoline, 1,3-Dichloro-5-methoxyisoquinoline 95%, 1,3-Dichloro-5-methoxyisoquinoline, 98%, 98%, 1,3-DICHLORO-5-METHOXYISOQUINOLINE, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
1,3-dichloro-5-methoxyisoquinoline (CAS 24623-38-9) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 1,3-dichloro-5-methoxyisoquinoline. InChIKey: DHWYGSPWPQXKME-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 1,3-dichloro-5-methoxyisoquinoline |
| InChIKey | DHWYGSPWPQXKME-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C(N=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)