Products 24623-40-3
CAS 24623-40-3 is the registry number for 1,3-Dichloro-7-methoxyisoquinoline, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
1,3-dichloro-7-methoxyisoquinoline (CAS 24623-40-3) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 1,3-dichloro-7-methoxyisoquinoline. InChIKey: SGQUBMFDFROOSK-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 1,3-dichloro-7-methoxyisoquinoline |
| InChIKey | SGQUBMFDFROOSK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(N=C(C=C2C=C1)Cl)Cl |
Computed by PubChem (NCBI)