CAS 2482-80-6 is the registry number for Ethimidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,4-bis(aziridin-1-yl)-6-chloropyrimidine (CAS 2482-80-6) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. IUPAC name: 2,4-bis(aziridin-1-yl)-6-chloropyrimidine. InChIKey: CUINYHNUVZSCAS-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 196.64 g/mol |
| IUPAC name | 2,4-bis(aziridin-1-yl)-6-chloropyrimidine |
| InChIKey | CUINYHNUVZSCAS-UHFFFAOYSA-N |
| SMILES | C1CN1C2=CC(=NC(=N2)N3CC3)Cl |
Computed by PubChem (NCBI)