Products 24821-18-9
CAS 24821-18-9 appears in our catalog under these names: 2-Nitro-6-(trifluoromethyl)benzoic acid, 95%, 2-Nitro-6-(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-nitro-6-(trifluoromethyl)benzoic acid (CAS 24821-18-9) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: 2-nitro-6-(trifluoromethyl)benzoic acid. InChIKey: AVBBEHFQLFYRGH-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO4 |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 2-nitro-6-(trifluoromethyl)benzoic acid |
| InChIKey | AVBBEHFQLFYRGH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)