CAS 320-94-5 appears in our catalog under these names: 2-Nitro-4-(trifluoromethyl)benzoic Acid, 2–Nitro–4–(trifluoromethyl)benzoic acid, 2-Nitro-4-(trifluoromethyl)benzoic acid, 98% , 2-Nitro-4-(trifluoromethyl)benzoic Acid, >98.0%(GC)(T), 2-Nitro-4-trifluoromethylbenzoic acid 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 10g, 1g, 25g, 100g, 500g, 2g, 5g, 0,025kg.
2-nitro-4-(trifluoromethyl)benzoic acid (CAS 320-94-5) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: 2-nitro-4-(trifluoromethyl)benzoic acid. InChIKey: MYSAXQPTXWKDPQ-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO4 |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 2-nitro-4-(trifluoromethyl)benzoic acid |
| InChIKey | MYSAXQPTXWKDPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)