CAS 1160683-73-7 is the registry number for Methyl 2,3,6-trifluoro-5-nitrobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,3,6-trifluoro-5-nitrobenzoate (CAS 1160683-73-7) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: methyl 2,3,6-trifluoro-5-nitrobenzoate. InChIKey: GFJPMILHQKKDPR-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO4 |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | methyl 2,3,6-trifluoro-5-nitrobenzoate |
| InChIKey | GFJPMILHQKKDPR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1F)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)