Products 167887-95-8
CAS 167887-95-8 appears in our catalog under these names: 2,4,5-Trifluoro-3-methyl-6-nitrobenzoic acid, 95%, 3-Methyl-6-nitro-2,4,5-trifluorobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 100g, 250g.
2,4,5-trifluoro-3-methyl-6-nitrobenzoic acid (CAS 167887-95-8) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: 2,4,5-trifluoro-3-methyl-6-nitrobenzoic acid. InChIKey: LXDITRBZRZATMT-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO4 |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-methyl-6-nitrobenzoic acid |
| InChIKey | LXDITRBZRZATMT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)F)[N+](=O)[O-])C(=O)O)F |
Computed by PubChem (NCBI)