Products 320-37-6
CAS 320-37-6 appears in our catalog under these names: 4-Nitro-2-(trifluoromethyl)benzoic acid, 98%, 4–Nitro–2–(trifluoromethyl)benzoic acid, 4-Nitro-2-(trifluoromethyl)benzoic acid, 97% , 4-Nitro-2-(trifluoromethyl)benzoic Acid, >97.0%(GC)(T), 4-Nitro-2-(trifluoromethyl)benzoic acid 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 25g, 100g, 1g, 500g, 5g, 10g.
4-nitro-2-(trifluoromethyl)benzoic acid (CAS 320-37-6) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: 4-nitro-2-(trifluoromethyl)benzoic acid. InChIKey: BPCKZQCTLCTDST-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO4 |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 4-nitro-2-(trifluoromethyl)benzoic acid |
| InChIKey | BPCKZQCTLCTDST-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)