Products 1227581-78-3

CAS 1227581-78-3 is the registry number for 2-Nitro-3-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-nitro-3-(trifluoromethyl)benzoic acid (CAS 1227581-78-3) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: 2-nitro-3-(trifluoromethyl)benzoic acid. InChIKey: SNRKODPBDWWCNL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4F3NO4
Molecular weight235.12 g/mol
IUPAC name2-nitro-3-(trifluoromethyl)benzoic acid
InChIKeySNRKODPBDWWCNL-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)C(F)(F)F)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)