Products 1227587-38-3

CAS 1227587-38-3 is the registry number for 3-Nitro-2-(trifluoromethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-nitro-2-(trifluoromethyl)benzoic acid (CAS 1227587-38-3) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: 3-nitro-2-(trifluoromethyl)benzoic acid. InChIKey: QBJMPJHHNMXJCB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4F3NO4
Molecular weight235.12 g/mol
IUPAC name3-nitro-2-(trifluoromethyl)benzoic acid
InChIKeyQBJMPJHHNMXJCB-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)[N+](=O)[O-])C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)