CAS 116965-16-3 appears in our catalog under these names: 3-Nitro-4-(trifluoromethyl)benzoic acid, 97%, 3-Nitro-4-trifluoromethylbenzoic Acid, >95% (HPLC), 3-Nitro-4-(trifluoromethyl)benzoic acid, 98%, 3-Nitro-4-(trifluoromethyl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, TRC, Fluorochem, Ambeed, Chemat. Available pack sizes: 10g, 100g, 5g, 25g, 1g.
3-nitro-4-(trifluoromethyl)benzoic acid (CAS 116965-16-3) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: 3-nitro-4-(trifluoromethyl)benzoic acid. InChIKey: NIWGMOJIGTUDFT-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO4 |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 3-nitro-4-(trifluoromethyl)benzoic acid |
| InChIKey | NIWGMOJIGTUDFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)