Products 1214373-54-2
CAS 1214373-54-2 appears in our catalog under these names: 2-Nitro-5-(trifluoromethyl)benzoic acid, 2-NITRO-5-TRIFLUOROMETHYLBENZOIC ACID, 98%, 2-nitro-5-(trifluoromethyl)benzoic acid, 95%, 2-Nitro-5-(trifluoromethyl)benzoic acid, 98%, 2-Nitro-5-(trifluoromethyl)benzoic acid 98%. Offered by: Biosynth, Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g, 10g.
2-nitro-5-(trifluoromethyl)benzoic acid (CAS 1214373-54-2) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: 2-nitro-5-(trifluoromethyl)benzoic acid. InChIKey: POSKCQXWHNDYKW-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO4 |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 2-nitro-5-(trifluoromethyl)benzoic acid |
| InChIKey | POSKCQXWHNDYKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)