Products 25243-38-3
CAS 25243-38-3 is the registry number for 1,2,3,4-Tetra-O-acetyl-b-D-arabinopyranose. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g, 100g.
[(3R,4R,5S,6S)-4,5,6-triacetyloxyoxan-3-yl] acetate (CAS 25243-38-3) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(3R,4R,5S,6S)-4,5,6-triacetyloxyoxan-3-yl] acetate. InChIKey: MJOQJPYNENPSSS-NDBYEHHHSA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(3R,4R,5S,6S)-4,5,6-triacetyloxyoxan-3-yl] acetate |
| InChIKey | MJOQJPYNENPSSS-NDBYEHHHSA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@H]([C@H]([C@@H]1OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)