Products 2563402-25-3
CAS 2563402-25-3 is the registry number for 6,8-dichloro-2,3-dimethylpyrido[2,3-b]pyrazine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6,8-dichloro-2,3-dimethylpyrido[2,3-b]pyrazine (CAS 2563402-25-3) is a chemical compound with the molecular formula C9H7Cl2N3 and a molecular weight of 228.07 g/mol. IUPAC name: 6,8-dichloro-2,3-dimethylpyrido[2,3-b]pyrazine. InChIKey: LEIWYQAEGLPJOL-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 6,8-dichloro-2,3-dimethylpyrido[2,3-b]pyrazine |
| InChIKey | LEIWYQAEGLPJOL-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=N1)C(=CC(=N2)Cl)Cl)C |
Computed by PubChem (NCBI)