CAS 257298-92-3 is the registry number for (R)-4,4,5,5-Tetramethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
4,4,5,5-tetramethyl-2-[(1R)-1-phenylethyl]-1,3,2-dioxaborolane (CAS 257298-92-3) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(1R)-1-phenylethyl]-1,3,2-dioxaborolane. InChIKey: VNYHYPMNRXFAAP-LLVKDONJSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(1R)-1-phenylethyl]-1,3,2-dioxaborolane |
| InChIKey | VNYHYPMNRXFAAP-LLVKDONJSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)[C@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)