CAS 174090-36-9 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane, 95-<97%, 4,4,5,5-Tetramethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane, 4,4,5,5-Tetramethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane, 95%+, 95%+, 4,4,5,5-Tetramethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane, 95+%. Offered by: Hoffman Fine Chemicals, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g, 100mg.
4,4,5,5-tetramethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane (CAS 174090-36-9) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane. InChIKey: VNYHYPMNRXFAAP-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(1-phenylethyl)-1,3,2-dioxaborolane |
| InChIKey | VNYHYPMNRXFAAP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)