CAS 26052-96-0 appears in our catalog under these names: 9H-Pyrido(3,4-b)indole-1-carboxylic acid, 95%, β–Carboline–1–carboxylic Acid, ß-Carboline-1-carboxylic acid, 9H-Pyrido(3,4-b)indole-1-carboxylic acid, β-Carboline-1-carboxylic acid. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 1g, 1mg, 5mg, 50mg, 0,5g, 5 mg, 1 mg.
9H-pyrido[3,4-b]indole-1-carboxylic acid (CAS 26052-96-0) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 9H-pyrido[3,4-b]indole-1-carboxylic acid. InChIKey: VNPNEGORDFERGK-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 9H-pyrido[3,4-b]indole-1-carboxylic acid |
| InChIKey | VNPNEGORDFERGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)C(=O)O |
Computed by PubChem (NCBI)