CAS 2613384-41-9 is the registry number for 4,8-Dibromo-2,6-naphthyridine, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4,8-dibromo-2,6-naphthyridine (CAS 2613384-41-9) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 4,8-dibromo-2,6-naphthyridine. InChIKey: HIZXINLLTAGUSZ-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 4,8-dibromo-2,6-naphthyridine |
| InChIKey | HIZXINLLTAGUSZ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=CC2=C(C=N1)Br)Br |
Computed by PubChem (NCBI)