CAS 261945-13-5 appears in our catalog under these names: 4,5-Difluoro-2-(trifluoromethyl)benzoic acid, 4,5-Difluoro-2-(trifluoromethyl)benzoic acid, 98%, 98%, 4,5-Difluoro-2-(trifluoromethyl)benzoic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g, 500mg, 10g.
4,5-difluoro-2-(trifluoromethyl)benzoic acid (CAS 261945-13-5) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 4,5-difluoro-2-(trifluoromethyl)benzoic acid. InChIKey: SXHRHFQRQJSVFH-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 4,5-difluoro-2-(trifluoromethyl)benzoic acid |
| InChIKey | SXHRHFQRQJSVFH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)