Products 2643367-53-5
CAS 2643367-53-5 is the registry number for 5-(benzyloxy)-2,4-difluorobenzoic acid, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,4-difluoro-5-phenylmethoxybenzoic acid (CAS 2643367-53-5) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 2,4-difluoro-5-phenylmethoxybenzoic acid. InChIKey: APFKHLNEQKGOJG-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 2,4-difluoro-5-phenylmethoxybenzoic acid |
| InChIKey | APFKHLNEQKGOJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C(=C2)C(=O)O)F)F |
Computed by PubChem (NCBI)