CAS 26879-83-4 is the registry number for 4-Hydroxy-3-nitrobenzaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(E)-hydroxyiminomethyl]-2-nitrophenol (CAS 26879-83-4) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 4-[(E)-hydroxyiminomethyl]-2-nitrophenol. InChIKey: HKAOGVGRPYOBEJ-XBXARRHUSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 4-[(E)-hydroxyiminomethyl]-2-nitrophenol |
| InChIKey | HKAOGVGRPYOBEJ-XBXARRHUSA-N |
| SMILES | C1=CC(=C(C=C1/C=N/O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)