CAS 332061-66-2 is the registry number for (R)–3–amino–4–(3,4–dichlorophenyl)butanoic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
(3R)-3-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride (CAS 332061-66-2) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: (3R)-3-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride. InChIKey: RNDGKTAEVJUWKK-OGFXRTJISA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | (3R)-3-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride |
| InChIKey | RNDGKTAEVJUWKK-OGFXRTJISA-N |
| SMILES | C1=CC(=C(C=C1C[C@H](CC(=O)O)N)Cl)Cl.Cl |
Computed by PubChem (NCBI)