CAS 27017-66-9 appears in our catalog under these names: 2,6-Dichloro-1,5-naphthyridine 95%, 2,6-Dichloro-1,5-naphthyridine, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2,6-dichloro-1,5-naphthyridine (CAS 27017-66-9) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,6-dichloro-1,5-naphthyridine. InChIKey: GMQKLOANTBSSHU-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,6-dichloro-1,5-naphthyridine |
| InChIKey | GMQKLOANTBSSHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)