Products 2704372-74-5
CAS 2704372-74-5 is the registry number for 1-(2,6-difluorophenyl)prop-2-en-1-amine hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2,6-difluorophenyl)prop-2-en-1-amine;hydrochloride (CAS 2704372-74-5) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 1-(2,6-difluorophenyl)prop-2-en-1-amine;hydrochloride. InChIKey: VCSYJYMHKLKDAT-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)prop-2-en-1-amine;hydrochloride |
| InChIKey | VCSYJYMHKLKDAT-UHFFFAOYSA-N |
| SMILES | C=CC(C1=C(C=CC=C1F)F)N.Cl |
Computed by PubChem (NCBI)