Products 2709492-28-2
CAS 2709492-28-2 is the registry number for 2,3-dichloro-7-methylthieno[2,3-b]pyrazine, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2,3-dichloro-7-methylthieno[2,3-b]pyrazine (CAS 2709492-28-2) is a chemical compound with the molecular formula C7H4Cl2N2S and a molecular weight of 219.09 g/mol. IUPAC name: 2,3-dichloro-7-methylthieno[2,3-b]pyrazine. InChIKey: NRPZMSXNYJWQSD-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2S |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | 2,3-dichloro-7-methylthieno[2,3-b]pyrazine |
| InChIKey | NRPZMSXNYJWQSD-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=C1N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)