CAS 27343-99-3 is the registry number for 3,3'-Dimethyl[1,1'-biphenyl]-4,4'-dicarboxaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
4-(4-formyl-3-methylphenyl)-2-methylbenzaldehyde (CAS 27343-99-3) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 4-(4-formyl-3-methylphenyl)-2-methylbenzaldehyde. InChIKey: OMVBTWICWLHSKH-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 4-(4-formyl-3-methylphenyl)-2-methylbenzaldehyde |
| InChIKey | OMVBTWICWLHSKH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)C=O)C)C=O |
Computed by PubChem (NCBI)