Products 2734773-83-0
CAS 2734773-83-0 is the registry number for 2-(2-Bromo-4,5-dichlorophenyl)-1,3-dioxolane, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-(2-bromo-4,5-dichlorophenyl)-1,3-dioxolane (CAS 2734773-83-0) is a chemical compound with the molecular formula C9H7BrCl2O2 and a molecular weight of 297.96 g/mol. IUPAC name: 2-(2-bromo-4,5-dichlorophenyl)-1,3-dioxolane. InChIKey: WDOPZOISEAGLKN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2O2 |
|---|---|
| Molecular weight | 297.96 g/mol |
| IUPAC name | 2-(2-bromo-4,5-dichlorophenyl)-1,3-dioxolane |
| InChIKey | WDOPZOISEAGLKN-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C=C2Br)Cl)Cl |
Computed by PubChem (NCBI)