Products 2734775-21-2
CAS 2734775-21-2 is the registry number for 3,5-Difluoro-4'-methyl-[1,1'-biphenyl]-4-carbaldehyde, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,6-difluoro-4-(4-methylphenyl)benzaldehyde (CAS 2734775-21-2) is a chemical compound with the molecular formula C14H10F2O and a molecular weight of 232.22 g/mol. IUPAC name: 2,6-difluoro-4-(4-methylphenyl)benzaldehyde. InChIKey: CIWMDJWRRXBAIR-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 2,6-difluoro-4-(4-methylphenyl)benzaldehyde |
| InChIKey | CIWMDJWRRXBAIR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=C(C(=C2)F)C=O)F |
Computed by PubChem (NCBI)