Products 27501-91-3
CAS 27501-91-3 is the registry number for Aeruginoic acid, 98.6%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
2-(2-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid (CAS 27501-91-3) is a chemical compound with the molecular formula C10H7NO3S and a molecular weight of 221.23 g/mol. IUPAC name: 2-(2-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: UCVBEULMPJTLLH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3S |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | 2-(2-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | UCVBEULMPJTLLH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=CS2)C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Aeruginoic acid, 2-(2-Hydroxyphenyl)-4-thiazolecarboxylic acid, 2-(2-hydroxyphenyl)thiazole-4-carboxylic acid, 4-Thiazolecarboxylic acid, 2-(2-hydroxyphenyl)-, 2-(2-hydroxyphenyl)-1,3-thiazole-4-carboxylic acid, orb2942978, UCVBEULMPJTLLH-UHFFFAOYSA-N, 2-(6-Oxocyclohexa-2,4-dien-1-ylidene)-2,3-dihydro-1,3-thiazole-4-carboxylic acid