Products 2750400-53-2
CAS 2750400-53-2 is the registry number for tert-Butyl ((1R,2R,4S)-2-methyl-7-azabicyclo[2.2.1]heptan-2-yl)carbamate oxalate, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
Tert-butyl N-[(1R,2R,4S)-2-methyl-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;oxalic acid (CAS 2750400-53-2) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: tert-butyl N-[(1R,2R,4S)-2-methyl-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;oxalic acid. InChIKey: WPJSSNVNNSXPFK-ZVMAQGLXSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R,4S)-2-methyl-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;oxalic acid |
| InChIKey | WPJSSNVNNSXPFK-ZVMAQGLXSA-N |
| SMILES | C[C@]1(C[C@@H]2CC[C@H]1N2)NC(=O)OC(C)(C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)