Products 2757731-43-2
CAS 2757731-43-2 is the registry number for bis (Boc-Azetidine). Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]azetidine-1-carboxylate (CAS 2757731-43-2) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: tert-butyl 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]azetidine-1-carboxylate. InChIKey: GNSWZLOOMVQNKV-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | tert-butyl 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]azetidine-1-carboxylate |
| InChIKey | GNSWZLOOMVQNKV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)