CAS 28004-62-8 appears in our catalog under these names: 2-AMINO-5-(4-CHLOROPHENYL)-1,3,4- &, 5-(4-Chlorophenyl)-1,3,4-thiadiazol-2-amine, 98%, 98%, 2-Amino-5-(4-chlorophenyl)-1,3,4-thiadiazole, 98%. Offered by: Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1G, 100mg, 250mg, 5g, 25g, 10g.
5-(4-chlorophenyl)-1,3,4-thiadiazol-2-amine (CAS 28004-62-8) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 5-(4-chlorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: OAVULPOOAHQYDZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | OAVULPOOAHQYDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)N)Cl |
Computed by PubChem (NCBI)