CAS 28165-60-8 appears in our catalog under these names: 2,3–Dichloro–6–nitrophenol, 2,3-Dichloro-6-nitrophenol 95%, 2,3-Dichloro-6-nitrophenol, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g, 100g.
2,3-dichloro-6-nitrophenol (CAS 28165-60-8) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,3-dichloro-6-nitrophenol. InChIKey: SJWMPHKDBJQBBJ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,3-dichloro-6-nitrophenol |
| InChIKey | SJWMPHKDBJQBBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])O)Cl)Cl |
Computed by PubChem (NCBI)