CAS 28252-76-8 appears in our catalog under these names: 2,8-Dichloro-1,5-naphthyridine, 95%, 2,8-Dichloro-1,5-naphthyridine, 97%, 2,8-dichloro-1,5-naphthyridine, 2,8-dichloro-1,5-naphthyridine, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 5g, 50mg, 500mg, 1000mg, 1g.
2,8-dichloro-1,5-naphthyridine (CAS 28252-76-8) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,8-dichloro-1,5-naphthyridine. InChIKey: PSSPSOSBJIWVGU-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,8-dichloro-1,5-naphthyridine |
| InChIKey | PSSPSOSBJIWVGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C(C=CN=C21)Cl)Cl |
Computed by PubChem (NCBI)