CAS 2826221-23-0 appears in our catalog under these names: HIF–1α–IN–4, HIF-1α-IN-4, 99.95%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 100 mg, 50 mg, 10 mg, 5 mg, 25 mg.
N-(4-acetylphenyl)-1,2-benzoxazole-3-carboxamide (CAS 2826221-23-0) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: N-(4-acetylphenyl)-1,2-benzoxazole-3-carboxamide. InChIKey: PLIVETCICWRHCP-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | N-(4-acetylphenyl)-1,2-benzoxazole-3-carboxamide |
| InChIKey | PLIVETCICWRHCP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)C2=NOC3=CC=CC=C32 |
Computed by PubChem (NCBI)