CAS 2828439-12-7 is the registry number for AChE-IN-83. Offered by: MedChemExpress. Available pack sizes: Get quote.
S-methyl 3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carbothioate (CAS 2828439-12-7) is a chemical compound with the molecular formula C10H7ClN2O2S and a molecular weight of 254.69 g/mol. IUPAC name: S-methyl 3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carbothioate. InChIKey: GPZBIRBOVSKYLP-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2S |
|---|---|
| Molecular weight | 254.69 g/mol |
| IUPAC name | S-methyl 3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carbothioate |
| InChIKey | GPZBIRBOVSKYLP-UHFFFAOYSA-N |
| SMILES | CSC(=O)C1=NC(=NO1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)