Products 2901066-79-1
CAS 2901066-79-1 is the registry number for 4-Chloro-2-hydroxy-3-(methylthio)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-2-hydroxy-3-methylsulfanylbenzoic acid (CAS 2901066-79-1) is a chemical compound with the molecular formula C8H7ClO3S and a molecular weight of 218.66 g/mol. IUPAC name: 4-chloro-2-hydroxy-3-methylsulfanylbenzoic acid. InChIKey: QPVQVHZADNDWGF-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3S |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 4-chloro-2-hydroxy-3-methylsulfanylbenzoic acid |
| InChIKey | QPVQVHZADNDWGF-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=CC(=C1O)C(=O)O)Cl |
Computed by PubChem (NCBI)