Products 2918877-18-4

CAS 2918877-18-4 is the registry number for 5-bromo-2,4-dichlorophenyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(5-bromo-2,4-dichlorophenyl) acetate (CAS 2918877-18-4) is a chemical compound with the molecular formula C8H5BrCl2O2 and a molecular weight of 283.93 g/mol. IUPAC name: (5-bromo-2,4-dichlorophenyl) acetate. InChIKey: MNMCLFXMDKNCMN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrCl2O2
Molecular weight283.93 g/mol
IUPAC name(5-bromo-2,4-dichlorophenyl) acetate
InChIKeyMNMCLFXMDKNCMN-UHFFFAOYSA-N
SMILESCC(=O)OC1=CC(=C(C=C1Cl)Cl)Br

Computed by PubChem (NCBI)