Products 2940858-83-1
CAS 2940858-83-1 is the registry number for cis-7-oxa-3-azabicyclo[4.2.0]octane,hemi(oxalic acid), 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Bis((1R,6R)-7-oxa-3-azabicyclo[4.2.0]octane);oxalic acid (CAS 2940858-83-1) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: bis((1R,6R)-7-oxa-3-azabicyclo[4.2.0]octane);oxalic acid. InChIKey: IKFRMDZXNAALOB-LDCPCGJSSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | bis((1R,6R)-7-oxa-3-azabicyclo[4.2.0]octane);oxalic acid |
| InChIKey | IKFRMDZXNAALOB-LDCPCGJSSA-N |
| SMILES | C1CNC[C@H]2[C@@H]1OC2.C1CNC[C@H]2[C@@H]1OC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)