Products 2940959-70-4
CAS 2940959-70-4 is the registry number for oxalic acid,1-oxaspiro[3.3]heptan-3-amine, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Oxalic acid;bis(1-oxaspiro[3.3]heptan-3-amine) (CAS 2940959-70-4) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: oxalic acid;bis(1-oxaspiro[3.3]heptan-3-amine). InChIKey: NWGYKSMXRQNZSJ-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | oxalic acid;bis(1-oxaspiro[3.3]heptan-3-amine) |
| InChIKey | NWGYKSMXRQNZSJ-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)C(CO2)N.C1CC2(C1)C(CO2)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)