Products 3025303-89-0
CAS 3025303-89-0 appears in our catalog under these names: 2-Methacrylamidoterephthalic acid, 98%, 2-Methacrylamidoterephthalic acid, 98%, 98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
2-(2-methylprop-2-enoylamino)terephthalic acid (CAS 3025303-89-0) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 2-(2-methylprop-2-enoylamino)terephthalic acid. InChIKey: SVBBCGMCIOGJFA-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 2-(2-methylprop-2-enoylamino)terephthalic acid |
| InChIKey | SVBBCGMCIOGJFA-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)NC1=C(C=CC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)