Products 133748-06-8

CAS 133748-06-8 is the registry number for 1-(1,3-Benzodioxol-5-yl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carboxylic acid (CAS 133748-06-8) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: GJSWABALJXFXDE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO5
Molecular weight249.22 g/mol
IUPAC name1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyGJSWABALJXFXDE-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=CC3=C(C=C2)OCO3)C(=O)O

Computed by PubChem (NCBI)